C16H29N3 — CID 143837613
1,5-dimethyl-6-methylidene-2,3-dihydropyrazine;(5Z)-1,5-dimethyl-3,4,7,8-tetrahydro-2H-azocine (PubChem CID 143837613) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is 1,5-dimethyl-6-methylidene-2,3-dihydropyrazine;(5Z)-1,5-dimethyl-3,4,7,8-tetrahydro-2H-azocine.
| Compound Name | 1,5-dimethyl-6-methylidene-2,3-dihydropyrazine;(5Z)-1,5-dimethyl-3,4,7,8-tetrahydro-2H-azocine |
|---|---|
| PubChem CID | 143837613 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | 1,5-dimethyl-6-methylidene-2,3-dihydropyrazine;(5Z)-1,5-dimethyl-3,4,7,8-tetrahydro-2H-azocine |
| SMILES | C/C1=C/CCN(C)CCC1.C=C1C(C)=NCCN1C |
| InChI | InChI=1S/C9H17N.C7H12N2/c1-9-5-3-7-10(2)8-4-6-9;1-6-7(2)9(3)5-4-8-6/h5H,3-4,6-8H2,1-2H3;2,4-5H2,1,3H3/b9-5-; |
| InChIKey | KXUQZWAJWCTRNZ-UYTGOYFPSA-N |
| XLogP | 2.95 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|