C17H35N2O+ — CID 143837679
methyl-[3-[methyl(2,2,4,4-tetramethylpentanoyl)amino]propyl]-prop-2-enylazanium (PubChem CID 143837679) has the molecular formula C17H35N2O+ and a molecular weight of 283.48 g/mol. Its IUPAC name is methyl-[3-[methyl(2,2,4,4-tetramethylpentanoyl)amino]propyl]-prop-2-enylazanium.
| Compound Name | methyl-[3-[methyl(2,2,4,4-tetramethylpentanoyl)amino]propyl]-prop-2-enylazanium |
|---|---|
| PubChem CID | 143837679 |
| Molecular Formula | C17H35N2O+ |
| Molecular Weight | 283.48 g/mol |
| Exact Mass | 283.27 |
| IUPAC Name | methyl-[3-[methyl(2,2,4,4-tetramethylpentanoyl)amino]propyl]-prop-2-enylazanium |
| SMILES | C=CC[NH+](C)CCCN(C)C(=O)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C17H34N2O/c1-9-11-18(7)12-10-13-19(8)15(20)17(5,6)14-16(2,3)4/h9H,1,10-14H2,2-8H3/p+1 |
| InChIKey | SYGLIDWFNZCUNI-UHFFFAOYSA-O |
| XLogP | 2.00 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.48 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|