About 2-methyl-6-[(Z,3E)-3-(5-methylidenecyclopent-2-en-1-ylidene)hex-4-en-1-ynyl]pyridine
2-methyl-6-[(Z,3E)-3-(5-methylidenecyclopent-2-en-1-ylidene)hex-4-en-1-ynyl]pyridine (PubChem CID 143838158) has the molecular formula C18H17N
and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-methyl-6-[(Z,3E)-3-(5-methylidenecyclopent-2-en-1-ylidene)hex-4-en-1-ynyl]pyridine.
Molecular Properties
| Compound Name | 2-methyl-6-[(Z,3E)-3-(5-methylidenecyclopent-2-en-1-ylidene)hex-4-en-1-ynyl]pyridine |
| PubChem CID | 143838158 |
| Molecular Formula | C18H17N |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2-methyl-6-[(Z,3E)-3-(5-methylidenecyclopent-2-en-1-ylidene)hex-4-en-1-ynyl]pyridine |
| SMILES | C=C1CC=C/C1=C(C#Cc1cccc(C)n1)/C=C\C |
| InChI | InChI=1S/C18H17N/c1-4-7-16(18-11-5-8-14(18)2)12-13-17-10-6-9-15(3)19-17/h4-7,9-11H,2,8H2,1,3H3/b7-4-,18-16+ |
| InChIKey | MUQYYGKIQUDRMY-VTJOPCHBSA-N |
| XLogP | 4.13 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-6-[(Z,3E)-3-(5-methylidenecyclopent-2-en-1-ylidene)hex-4-en-1-ynyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-[(Z,3E)-3-(5-methylidenecyclopent-2-en-1-ylidene)hex-4-en-1-ynyl]pyridine?
The IUPAC name of 2-methyl-6-[(Z,3E)-3-(5-methylidenecyclopent-2-en-1-ylidene)hex-4-en-1-ynyl]pyridine (CID 143838158) is 2-methyl-6-[(Z,3E)-3-(5-methylidenecyclopent-2-en-1-ylidene)hex-4-en-1-ynyl]pyridine.
What is the SMILES notation for 2-methyl-6-[(Z,3E)-3-(5-methylidenecyclopent-2-en-1-ylidene)hex-4-en-1-ynyl]pyridine?
The canonical SMILES for 2-methyl-6-[(Z,3E)-3-(5-methylidenecyclopent-2-en-1-ylidene)hex-4-en-1-ynyl]pyridine is C=C1CC=C/C1=C(C#Cc1cccc(C)n1)/C=C\C.
What is the InChIKey of 2-methyl-6-[(Z,3E)-3-(5-methylidenecyclopent-2-en-1-ylidene)hex-4-en-1-ynyl]pyridine?
The InChIKey is MUQYYGKIQUDRMY-VTJOPCHBSA-N. The full InChI is InChI=1S/C18H17N/c1-4-7-16(18-11-5-8-14(18)2)12-13-17-10-6-9-15(3)19-17/h4-7,9-11H,2,8H2,1,3H3/b7-4-,18-16+.
What are the key properties of 2-methyl-6-[(Z,3E)-3-(5-methylidenecyclopent-2-en-1-ylidene)hex-4-en-1-ynyl]pyridine?
2-methyl-6-[(Z,3E)-3-(5-methylidenecyclopent-2-en-1-ylidene)hex-4-en-1-ynyl]pyridine has a molecular weight of 247.34 g/mol, XLogP of 4.13, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-[(Z,3E)-3-(5-methylidenecyclopent-2-en-1-ylidene)hex-4-en-1-ynyl]pyridine is sourced from PubChem (CID 143838158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).