About 3-(dimethylamino)-N-ethylcyclopenta-2,4-diene-1-carboxamide
3-(dimethylamino)-N-ethylcyclopenta-2,4-diene-1-carboxamide (PubChem CID 143838215) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-(dimethylamino)-N-ethylcyclopenta-2,4-diene-1-carboxamide.
Molecular Properties
| Compound Name | 3-(dimethylamino)-N-ethylcyclopenta-2,4-diene-1-carboxamide |
| PubChem CID | 143838215 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 3-(dimethylamino)-N-ethylcyclopenta-2,4-diene-1-carboxamide |
| SMILES | CCNC(=O)C1C=CC(N(C)C)=C1 |
| InChI | InChI=1S/C10H16N2O/c1-4-11-10(13)8-5-6-9(7-8)12(2)3/h5-8H,4H2,1-3H3,(H,11,13) |
| InChIKey | RZXJOOWXZPHKND-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(dimethylamino)-N-ethylcyclopenta-2,4-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)-N-ethylcyclopenta-2,4-diene-1-carboxamide?
The IUPAC name of 3-(dimethylamino)-N-ethylcyclopenta-2,4-diene-1-carboxamide (CID 143838215) is 3-(dimethylamino)-N-ethylcyclopenta-2,4-diene-1-carboxamide.
What is the SMILES notation for 3-(dimethylamino)-N-ethylcyclopenta-2,4-diene-1-carboxamide?
The canonical SMILES for 3-(dimethylamino)-N-ethylcyclopenta-2,4-diene-1-carboxamide is CCNC(=O)C1C=CC(N(C)C)=C1.
What is the InChIKey of 3-(dimethylamino)-N-ethylcyclopenta-2,4-diene-1-carboxamide?
The InChIKey is RZXJOOWXZPHKND-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c1-4-11-10(13)8-5-6-9(7-8)12(2)3/h5-8H,4H2,1-3H3,(H,11,13).
What are the key properties of 3-(dimethylamino)-N-ethylcyclopenta-2,4-diene-1-carboxamide?
3-(dimethylamino)-N-ethylcyclopenta-2,4-diene-1-carboxamide has a molecular weight of 180.25 g/mol, XLogP of 0.75, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)-N-ethylcyclopenta-2,4-diene-1-carboxamide is sourced from PubChem (CID 143838215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).