About propan-2-one;[(3E,5Z)-3-[(Z)-prop-1-enyl]-4-prop-1-en-2-ylhepta-3,5-dien-1-ynyl]benzene
propan-2-one;[(3E,5Z)-3-[(Z)-prop-1-enyl]-4-prop-1-en-2-ylhepta-3,5-dien-1-ynyl]benzene (PubChem CID 143838244) has the molecular formula C22H26O
and a molecular weight of 306.45 g/mol. Its IUPAC name is propan-2-one;[(3E,5Z)-3-[(Z)-prop-1-enyl]-4-prop-1-en-2-ylhepta-3,5-dien-1-ynyl]benzene.
Molecular Properties
| Compound Name | propan-2-one;[(3E,5Z)-3-[(Z)-prop-1-enyl]-4-prop-1-en-2-ylhepta-3,5-dien-1-ynyl]benzene |
| PubChem CID | 143838244 |
| Molecular Formula | C22H26O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | propan-2-one;[(3E,5Z)-3-[(Z)-prop-1-enyl]-4-prop-1-en-2-ylhepta-3,5-dien-1-ynyl]benzene |
| SMILES | C=C(C)C(/C=C\C)=C(C#Cc1ccccc1)\C=C/C.CC(C)=O |
| InChI | InChI=1S/C19H20.C3H6O/c1-5-10-18(19(11-6-2)16(3)4)15-14-17-12-8-7-9-13-17;1-3(2)4/h5-13H,3H2,1-2,4H3;1-2H3/b10-5-,11-6-,19-18+; |
| InChIKey | IANWJKLCLDQGOM-BADMVNEUSA-N |
| XLogP | 5.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze propan-2-one;[(3E,5Z)-3-[(Z)-prop-1-enyl]-4-prop-1-en-2-ylhepta-3,5-dien-1-ynyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-one;[(3E,5Z)-3-[(Z)-prop-1-enyl]-4-prop-1-en-2-ylhepta-3,5-dien-1-ynyl]benzene?
The IUPAC name of propan-2-one;[(3E,5Z)-3-[(Z)-prop-1-enyl]-4-prop-1-en-2-ylhepta-3,5-dien-1-ynyl]benzene (CID 143838244) is propan-2-one;[(3E,5Z)-3-[(Z)-prop-1-enyl]-4-prop-1-en-2-ylhepta-3,5-dien-1-ynyl]benzene.
What is the SMILES notation for propan-2-one;[(3E,5Z)-3-[(Z)-prop-1-enyl]-4-prop-1-en-2-ylhepta-3,5-dien-1-ynyl]benzene?
The canonical SMILES for propan-2-one;[(3E,5Z)-3-[(Z)-prop-1-enyl]-4-prop-1-en-2-ylhepta-3,5-dien-1-ynyl]benzene is C=C(C)C(/C=C\C)=C(C#Cc1ccccc1)\C=C/C.CC(C)=O.
What is the InChIKey of propan-2-one;[(3E,5Z)-3-[(Z)-prop-1-enyl]-4-prop-1-en-2-ylhepta-3,5-dien-1-ynyl]benzene?
The InChIKey is IANWJKLCLDQGOM-BADMVNEUSA-N. The full InChI is InChI=1S/C19H20.C3H6O/c1-5-10-18(19(11-6-2)16(3)4)15-14-17-12-8-7-9-13-17;1-3(2)4/h5-13H,3H2,1-2,4H3;1-2H3/b10-5-,11-6-,19-18+;.
What are the key properties of propan-2-one;[(3E,5Z)-3-[(Z)-prop-1-enyl]-4-prop-1-en-2-ylhepta-3,5-dien-1-ynyl]benzene?
propan-2-one;[(3E,5Z)-3-[(Z)-prop-1-enyl]-4-prop-1-en-2-ylhepta-3,5-dien-1-ynyl]benzene has a molecular weight of 306.45 g/mol, XLogP of 5.66, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-one;[(3E,5Z)-3-[(Z)-prop-1-enyl]-4-prop-1-en-2-ylhepta-3,5-dien-1-ynyl]benzene is sourced from PubChem (CID 143838244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).