C13H24OS2 — CID 14383835
methyl (2R,3R,4S)-4-cyclohexyl-3-hydroxy-2-methylpentanedithioate (PubChem CID 14383835) has the molecular formula C13H24OS2 and a molecular weight of 260.47 g/mol. Its IUPAC name is methyl (2R,3R,4S)-4-cyclohexyl-3-hydroxy-2-methylpentanedithioate.
| Compound Name | methyl (2R,3R,4S)-4-cyclohexyl-3-hydroxy-2-methylpentanedithioate |
|---|---|
| PubChem CID | 14383835 |
| Molecular Formula | C13H24OS2 |
| Molecular Weight | 260.47 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | methyl (2R,3R,4S)-4-cyclohexyl-3-hydroxy-2-methylpentanedithioate |
| SMILES | CSC(=S)[C@H](C)[C@H](O)[C@@H](C)C1CCCCC1 |
| InChI | InChI=1S/C13H24OS2/c1-9(11-7-5-4-6-8-11)12(14)10(2)13(15)16-3/h9-12,14H,4-8H2,1-3H3/t9-,10+,12+/m0/s1 |
| InChIKey | BLJIIVBYGHCVJB-HOSYDEDBSA-N |
| XLogP | 3.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|