About (1E)-1,5-dichloro-3-methylhexa-1,5-diene
(1E)-1,5-dichloro-3-methylhexa-1,5-diene (PubChem CID 143838570) has the molecular formula C7H10Cl2
and a molecular weight of 165.06 g/mol. Its IUPAC name is (1E)-1,5-dichloro-3-methylhexa-1,5-diene.
Molecular Properties
| Compound Name | (1E)-1,5-dichloro-3-methylhexa-1,5-diene |
| PubChem CID | 143838570 |
| Molecular Formula | C7H10Cl2 |
| Molecular Weight | 165.06 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | (1E)-1,5-dichloro-3-methylhexa-1,5-diene |
| SMILES | C=C(Cl)CC(C)/C=C/Cl |
| InChI | InChI=1S/C7H10Cl2/c1-6(3-4-8)5-7(2)9/h3-4,6H,2,5H2,1H3/b4-3+ |
| InChIKey | CSLFBCHMOZOOQF-ONEGZZNKSA-N |
| XLogP | 3.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.06 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (1E)-1,5-dichloro-3-methylhexa-1,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1,5-dichloro-3-methylhexa-1,5-diene?
The IUPAC name of (1E)-1,5-dichloro-3-methylhexa-1,5-diene (CID 143838570) is (1E)-1,5-dichloro-3-methylhexa-1,5-diene.
What is the SMILES notation for (1E)-1,5-dichloro-3-methylhexa-1,5-diene?
The canonical SMILES for (1E)-1,5-dichloro-3-methylhexa-1,5-diene is C=C(Cl)CC(C)/C=C/Cl.
What is the InChIKey of (1E)-1,5-dichloro-3-methylhexa-1,5-diene?
The InChIKey is CSLFBCHMOZOOQF-ONEGZZNKSA-N. The full InChI is InChI=1S/C7H10Cl2/c1-6(3-4-8)5-7(2)9/h3-4,6H,2,5H2,1H3/b4-3+.
What are the key properties of (1E)-1,5-dichloro-3-methylhexa-1,5-diene?
(1E)-1,5-dichloro-3-methylhexa-1,5-diene has a molecular weight of 165.06 g/mol, XLogP of 3.52, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1,5-dichloro-3-methylhexa-1,5-diene is sourced from PubChem (CID 143838570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).