About N-[(1Z)-2-ethylbuta-1,3-dienyl]methanimine;4-methylpyridine
N-[(1Z)-2-ethylbuta-1,3-dienyl]methanimine;4-methylpyridine (PubChem CID 143838581) has the molecular formula C13H18N2
and a molecular weight of 202.30 g/mol. Its IUPAC name is N-[(1Z)-2-ethylbuta-1,3-dienyl]methanimine;4-methylpyridine.
Molecular Properties
| Compound Name | N-[(1Z)-2-ethylbuta-1,3-dienyl]methanimine;4-methylpyridine |
| PubChem CID | 143838581 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | N-[(1Z)-2-ethylbuta-1,3-dienyl]methanimine;4-methylpyridine |
| SMILES | C=C/C(=C\N=C)CC.Cc1ccncc1 |
| InChI | InChI=1S/C7H11N.C6H7N/c1-4-7(5-2)6-8-3;1-6-2-4-7-5-3-6/h4,6H,1,3,5H2,2H3;2-5H,1H3/b7-6+; |
| InChIKey | NALNBJRLZSEKAX-UHDJGPCESA-N |
| XLogP | 3.56 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1Z)-2-ethylbuta-1,3-dienyl]methanimine;4-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1Z)-2-ethylbuta-1,3-dienyl]methanimine;4-methylpyridine?
The IUPAC name of N-[(1Z)-2-ethylbuta-1,3-dienyl]methanimine;4-methylpyridine (CID 143838581) is N-[(1Z)-2-ethylbuta-1,3-dienyl]methanimine;4-methylpyridine.
What is the SMILES notation for N-[(1Z)-2-ethylbuta-1,3-dienyl]methanimine;4-methylpyridine?
The canonical SMILES for N-[(1Z)-2-ethylbuta-1,3-dienyl]methanimine;4-methylpyridine is C=C/C(=C\N=C)CC.Cc1ccncc1.
What is the InChIKey of N-[(1Z)-2-ethylbuta-1,3-dienyl]methanimine;4-methylpyridine?
The InChIKey is NALNBJRLZSEKAX-UHDJGPCESA-N. The full InChI is InChI=1S/C7H11N.C6H7N/c1-4-7(5-2)6-8-3;1-6-2-4-7-5-3-6/h4,6H,1,3,5H2,2H3;2-5H,1H3/b7-6+;.
What are the key properties of N-[(1Z)-2-ethylbuta-1,3-dienyl]methanimine;4-methylpyridine?
N-[(1Z)-2-ethylbuta-1,3-dienyl]methanimine;4-methylpyridine has a molecular weight of 202.30 g/mol, XLogP of 3.56, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1Z)-2-ethylbuta-1,3-dienyl]methanimine;4-methylpyridine is sourced from PubChem (CID 143838581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).