C30H28FN3O7 — CID 143838660
benzyl 2-(6-fluoro-1H-indole-3-carbonyl)-4-(4-nitrobenzoyl)oxypyrrolidine-1-carboxylate;ethane (PubChem CID 143838660) has the molecular formula C30H28FN3O7 and a molecular weight of 561.57 g/mol. Its IUPAC name is benzyl 2-(6-fluoro-1H-indole-3-carbonyl)-4-(4-nitrobenzoyl)oxypyrrolidine-1-carboxylate;ethane.
| Compound Name | benzyl 2-(6-fluoro-1H-indole-3-carbonyl)-4-(4-nitrobenzoyl)oxypyrrolidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 143838660 |
| Molecular Formula | C30H28FN3O7 |
| Molecular Weight | 561.57 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | benzyl 2-(6-fluoro-1H-indole-3-carbonyl)-4-(4-nitrobenzoyl)oxypyrrolidine-1-carboxylate;ethane |
| SMILES | CC.O=C(OC1CC(C(=O)c2c[nH]c3cc(F)ccc23)N(C(=O)OCc2ccccc2)C1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H22FN3O7.C2H6/c29-19-8-11-22-23(14-30-24(22)12-19)26(33)25-13-21(39-27(34)18-6-9-20(10-7-18)32(36)37)15-31(25)28(35)38-16-17-4-2-1-3-5-17;1-2/h1-12,14,21,25,30H,13,15-16H2;1-2H3 |
| InChIKey | VLHDZKFUHLUBQI-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 131.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.57 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|