About N-(2-bromo-5-fluorocyclohexa-1,5-dien-1-yl)acetamide;methanamine
N-(2-bromo-5-fluorocyclohexa-1,5-dien-1-yl)acetamide;methanamine (PubChem CID 143838665) has the molecular formula C9H14BrFN2O
and a molecular weight of 265.13 g/mol. Its IUPAC name is N-(2-bromo-5-fluorocyclohexa-1,5-dien-1-yl)acetamide;methanamine.
Molecular Properties
| Compound Name | N-(2-bromo-5-fluorocyclohexa-1,5-dien-1-yl)acetamide;methanamine |
| PubChem CID | 143838665 |
| Molecular Formula | C9H14BrFN2O |
| Molecular Weight | 265.13 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | N-(2-bromo-5-fluorocyclohexa-1,5-dien-1-yl)acetamide;methanamine |
| SMILES | CC(=O)NC1=C(Br)CCC(F)=C1.CN |
| InChI | InChI=1S/C8H9BrFNO.CH5N/c1-5(12)11-8-4-6(10)2-3-7(8)9;1-2/h4H,2-3H2,1H3,(H,11,12);2H2,1H3 |
| InChIKey | XBKXYIYGKYPJAD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.13 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-bromo-5-fluorocyclohexa-1,5-dien-1-yl)acetamide;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromo-5-fluorocyclohexa-1,5-dien-1-yl)acetamide;methanamine?
The IUPAC name of N-(2-bromo-5-fluorocyclohexa-1,5-dien-1-yl)acetamide;methanamine (CID 143838665) is N-(2-bromo-5-fluorocyclohexa-1,5-dien-1-yl)acetamide;methanamine.
What is the SMILES notation for N-(2-bromo-5-fluorocyclohexa-1,5-dien-1-yl)acetamide;methanamine?
The canonical SMILES for N-(2-bromo-5-fluorocyclohexa-1,5-dien-1-yl)acetamide;methanamine is CC(=O)NC1=C(Br)CCC(F)=C1.CN.
What is the InChIKey of N-(2-bromo-5-fluorocyclohexa-1,5-dien-1-yl)acetamide;methanamine?
The InChIKey is XBKXYIYGKYPJAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrFNO.CH5N/c1-5(12)11-8-4-6(10)2-3-7(8)9;1-2/h4H,2-3H2,1H3,(H,11,12);2H2,1H3.
What are the key properties of N-(2-bromo-5-fluorocyclohexa-1,5-dien-1-yl)acetamide;methanamine?
N-(2-bromo-5-fluorocyclohexa-1,5-dien-1-yl)acetamide;methanamine has a molecular weight of 265.13 g/mol, XLogP of 1.95, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromo-5-fluorocyclohexa-1,5-dien-1-yl)acetamide;methanamine is sourced from PubChem (CID 143838665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).