About ethane;5-ethenyl-3-methyl-6-[(Z)-prop-1-enyl]-4H-1,3-oxazin-2-one
ethane;5-ethenyl-3-methyl-6-[(Z)-prop-1-enyl]-4H-1,3-oxazin-2-one (PubChem CID 143838743) has the molecular formula C14H25NO2
and a molecular weight of 239.36 g/mol. Its IUPAC name is ethane;5-ethenyl-3-methyl-6-[(Z)-prop-1-enyl]-4H-1,3-oxazin-2-one.
Molecular Properties
| Compound Name | ethane;5-ethenyl-3-methyl-6-[(Z)-prop-1-enyl]-4H-1,3-oxazin-2-one |
| PubChem CID | 143838743 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | ethane;5-ethenyl-3-methyl-6-[(Z)-prop-1-enyl]-4H-1,3-oxazin-2-one |
| SMILES | C=CC1=C(/C=C\C)OC(=O)N(C)C1.CC.CC |
| InChI | InChI=1S/C10H13NO2.2C2H6/c1-4-6-9-8(5-2)7-11(3)10(12)13-9;2*1-2/h4-6H,2,7H2,1,3H3;2*1-2H3/b6-4-;; |
| InChIKey | MRMQVDIHZBQISQ-XFUGJFOESA-N |
| XLogP | 4.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;5-ethenyl-3-methyl-6-[(Z)-prop-1-enyl]-4H-1,3-oxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-ethenyl-3-methyl-6-[(Z)-prop-1-enyl]-4H-1,3-oxazin-2-one?
The IUPAC name of ethane;5-ethenyl-3-methyl-6-[(Z)-prop-1-enyl]-4H-1,3-oxazin-2-one (CID 143838743) is ethane;5-ethenyl-3-methyl-6-[(Z)-prop-1-enyl]-4H-1,3-oxazin-2-one.
What is the SMILES notation for ethane;5-ethenyl-3-methyl-6-[(Z)-prop-1-enyl]-4H-1,3-oxazin-2-one?
The canonical SMILES for ethane;5-ethenyl-3-methyl-6-[(Z)-prop-1-enyl]-4H-1,3-oxazin-2-one is C=CC1=C(/C=C\C)OC(=O)N(C)C1.CC.CC.
What is the InChIKey of ethane;5-ethenyl-3-methyl-6-[(Z)-prop-1-enyl]-4H-1,3-oxazin-2-one?
The InChIKey is MRMQVDIHZBQISQ-XFUGJFOESA-N. The full InChI is InChI=1S/C10H13NO2.2C2H6/c1-4-6-9-8(5-2)7-11(3)10(12)13-9;2*1-2/h4-6H,2,7H2,1,3H3;2*1-2H3/b6-4-;;.
What are the key properties of ethane;5-ethenyl-3-methyl-6-[(Z)-prop-1-enyl]-4H-1,3-oxazin-2-one?
ethane;5-ethenyl-3-methyl-6-[(Z)-prop-1-enyl]-4H-1,3-oxazin-2-one has a molecular weight of 239.36 g/mol, XLogP of 4.14, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-ethenyl-3-methyl-6-[(Z)-prop-1-enyl]-4H-1,3-oxazin-2-one is sourced from PubChem (CID 143838743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).