About 5,6-bis(ethenyl)-3-methyl-1,3-oxazine-2,4-dione;ethane
5,6-bis(ethenyl)-3-methyl-1,3-oxazine-2,4-dione;ethane (PubChem CID 143838760) has the molecular formula C13H21NO3
and a molecular weight of 239.31 g/mol. Its IUPAC name is 5,6-bis(ethenyl)-3-methyl-1,3-oxazine-2,4-dione;ethane.
Molecular Properties
| Compound Name | 5,6-bis(ethenyl)-3-methyl-1,3-oxazine-2,4-dione;ethane |
| PubChem CID | 143838760 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 5,6-bis(ethenyl)-3-methyl-1,3-oxazine-2,4-dione;ethane |
| SMILES | C=Cc1oc(=O)n(C)c(=O)c1C=C.CC.CC |
| InChI | InChI=1S/C9H9NO3.2C2H6/c1-4-6-7(5-2)13-9(12)10(3)8(6)11;2*1-2/h4-5H,1-2H2,3H3;2*1-2H3 |
| InChIKey | MOYPIVUAGNNHPC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,6-bis(ethenyl)-3-methyl-1,3-oxazine-2,4-dione;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-bis(ethenyl)-3-methyl-1,3-oxazine-2,4-dione;ethane?
The IUPAC name of 5,6-bis(ethenyl)-3-methyl-1,3-oxazine-2,4-dione;ethane (CID 143838760) is 5,6-bis(ethenyl)-3-methyl-1,3-oxazine-2,4-dione;ethane.
What is the SMILES notation for 5,6-bis(ethenyl)-3-methyl-1,3-oxazine-2,4-dione;ethane?
The canonical SMILES for 5,6-bis(ethenyl)-3-methyl-1,3-oxazine-2,4-dione;ethane is C=Cc1oc(=O)n(C)c(=O)c1C=C.CC.CC.
What is the InChIKey of 5,6-bis(ethenyl)-3-methyl-1,3-oxazine-2,4-dione;ethane?
The InChIKey is MOYPIVUAGNNHPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3.2C2H6/c1-4-6-7(5-2)13-9(12)10(3)8(6)11;2*1-2/h4-5H,1-2H2,3H3;2*1-2H3.
What are the key properties of 5,6-bis(ethenyl)-3-methyl-1,3-oxazine-2,4-dione;ethane?
5,6-bis(ethenyl)-3-methyl-1,3-oxazine-2,4-dione;ethane has a molecular weight of 239.31 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-bis(ethenyl)-3-methyl-1,3-oxazine-2,4-dione;ethane is sourced from PubChem (CID 143838760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).