About ethane;4-ethenyl-2,5-dimethyl-1,3-oxazole
ethane;4-ethenyl-2,5-dimethyl-1,3-oxazole (PubChem CID 143838762) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is ethane;4-ethenyl-2,5-dimethyl-1,3-oxazole.
Molecular Properties
| Compound Name | ethane;4-ethenyl-2,5-dimethyl-1,3-oxazole |
| PubChem CID | 143838762 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | ethane;4-ethenyl-2,5-dimethyl-1,3-oxazole |
| SMILES | C=Cc1nc(C)oc1C.CC.CC.CC |
| InChI | InChI=1S/C7H9NO.3C2H6/c1-4-7-5(2)9-6(3)8-7;3*1-2/h4H,1H2,2-3H3;3*1-2H3 |
| InChIKey | IIYBQHOXGAZUDK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-ethenyl-2,5-dimethyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-ethenyl-2,5-dimethyl-1,3-oxazole?
The IUPAC name of ethane;4-ethenyl-2,5-dimethyl-1,3-oxazole (CID 143838762) is ethane;4-ethenyl-2,5-dimethyl-1,3-oxazole.
What is the SMILES notation for ethane;4-ethenyl-2,5-dimethyl-1,3-oxazole?
The canonical SMILES for ethane;4-ethenyl-2,5-dimethyl-1,3-oxazole is C=Cc1nc(C)oc1C.CC.CC.CC.
What is the InChIKey of ethane;4-ethenyl-2,5-dimethyl-1,3-oxazole?
The InChIKey is IIYBQHOXGAZUDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO.3C2H6/c1-4-7-5(2)9-6(3)8-7;3*1-2/h4H,1H2,2-3H3;3*1-2H3.
What are the key properties of ethane;4-ethenyl-2,5-dimethyl-1,3-oxazole?
ethane;4-ethenyl-2,5-dimethyl-1,3-oxazole has a molecular weight of 213.36 g/mol, XLogP of 5.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-ethenyl-2,5-dimethyl-1,3-oxazole is sourced from PubChem (CID 143838762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).