About ethane;3-methyl-5,6,7,8-tetrahydroquinoline
ethane;3-methyl-5,6,7,8-tetrahydroquinoline (PubChem CID 143839109) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is ethane;3-methyl-5,6,7,8-tetrahydroquinoline.
Molecular Properties
| Compound Name | ethane;3-methyl-5,6,7,8-tetrahydroquinoline |
| PubChem CID | 143839109 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | ethane;3-methyl-5,6,7,8-tetrahydroquinoline |
| SMILES | CC.Cc1cnc2c(c1)CCCC2 |
| InChI | InChI=1S/C10H13N.C2H6/c1-8-6-9-4-2-3-5-10(9)11-7-8;1-2/h6-7H,2-5H2,1H3;1-2H3 |
| InChIKey | SRJGLTMLOGNOCF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;3-methyl-5,6,7,8-tetrahydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-5,6,7,8-tetrahydroquinoline?
The IUPAC name of ethane;3-methyl-5,6,7,8-tetrahydroquinoline (CID 143839109) is ethane;3-methyl-5,6,7,8-tetrahydroquinoline.
What is the SMILES notation for ethane;3-methyl-5,6,7,8-tetrahydroquinoline?
The canonical SMILES for ethane;3-methyl-5,6,7,8-tetrahydroquinoline is CC.Cc1cnc2c(c1)CCCC2.
What is the InChIKey of ethane;3-methyl-5,6,7,8-tetrahydroquinoline?
The InChIKey is SRJGLTMLOGNOCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N.C2H6/c1-8-6-9-4-2-3-5-10(9)11-7-8;1-2/h6-7H,2-5H2,1H3;1-2H3.
What are the key properties of ethane;3-methyl-5,6,7,8-tetrahydroquinoline?
ethane;3-methyl-5,6,7,8-tetrahydroquinoline has a molecular weight of 177.29 g/mol, XLogP of 3.30, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-5,6,7,8-tetrahydroquinoline is sourced from PubChem (CID 143839109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).