C12H19N — CID 143839109
ethane;3-methyl-5,6,7,8-tetrahydroquinoline (PubChem CID 143839109) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is ethane;3-methyl-5,6,7,8-tetrahydroquinoline.
| Compound Name | ethane;3-methyl-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 143839109 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | ethane;3-methyl-5,6,7,8-tetrahydroquinoline |
| SMILES | CC.Cc1cnc2c(c1)CCCC2 |
| InChI | InChI=1S/C10H13N.C2H6/c1-8-6-9-4-2-3-5-10(9)11-7-8;1-2/h6-7H,2-5H2,1H3;1-2H3 |
| InChIKey | SRJGLTMLOGNOCF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |