C26H39N5O4 — CID 143839255
(3aS,6aR)-5-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]-N,N-dimethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide;acetic acid;toluene (PubChem CID 143839255) has the molecular formula C26H39N5O4 and a molecular weight of 485.63 g/mol. Its IUPAC name is (3aS,6aR)-5-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]-N,N-dimethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide;acetic acid;toluene.
| Compound Name | (3aS,6aR)-5-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]-N,N-dimethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide;acetic acid;toluene |
|---|---|
| PubChem CID | 143839255 |
| Molecular Formula | C26H39N5O4 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | (3aS,6aR)-5-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]-N,N-dimethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide;acetic acid;toluene |
| SMILES | CC(=O)O.CN(C)C(=O)N1C[C@H]2CC(NCC(=O)N3CCCC3C#N)C[C@H]2C1.Cc1ccccc1 |
| InChI | InChI=1S/C17H27N5O2.C7H8.C2H4O2/c1-20(2)17(24)21-10-12-6-14(7-13(12)11-21)19-9-16(23)22-5-3-4-15(22)8-18;1-7-5-3-2-4-6-7;1-2(3)4/h12-15,19H,3-7,9-11H2,1-2H3;2-6H,1H3;1H3,(H,3,4)/t12-,13+,14?,15?;; |
| InChIKey | GZZJVLTVXOUKHG-YPCNGGAVSA-N |
| XLogP | 2.57 |
| TPSA | 116.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |