C10H18N2O — CID 143839300
(3aS,6aR)-N,N-dimethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide (PubChem CID 143839300) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is (3aS,6aR)-N,N-dimethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide.
| Compound Name | (3aS,6aR)-N,N-dimethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 143839300 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | (3aS,6aR)-N,N-dimethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
| SMILES | CN(C)C(=O)N1C[C@H]2CCC[C@H]2C1 |
| InChI | InChI=1S/C10H18N2O/c1-11(2)10(13)12-6-8-4-3-5-9(8)7-12/h8-9H,3-7H2,1-2H3/t8-,9+ |
| InChIKey | CKJKAXBWBUBBKI-DTORHVGOSA-N |
| XLogP | 1.40 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |