About 3-(3,5-difluorophenyl)-4,6-dimethylpyridazine;ethane
3-(3,5-difluorophenyl)-4,6-dimethylpyridazine;ethane (PubChem CID 143839774) has the molecular formula C14H16F2N2
and a molecular weight of 250.29 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-4,6-dimethylpyridazine;ethane.
Molecular Properties
| Compound Name | 3-(3,5-difluorophenyl)-4,6-dimethylpyridazine;ethane |
| PubChem CID | 143839774 |
| Molecular Formula | C14H16F2N2 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 3-(3,5-difluorophenyl)-4,6-dimethylpyridazine;ethane |
| SMILES | CC.Cc1cc(C)c(-c2cc(F)cc(F)c2)nn1 |
| InChI | InChI=1S/C12H10F2N2.C2H6/c1-7-3-8(2)15-16-12(7)9-4-10(13)6-11(14)5-9;1-2/h3-6H,1-2H3;1-2H3 |
| InChIKey | CMGXMCSSOCCRFT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,5-difluorophenyl)-4,6-dimethylpyridazine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-difluorophenyl)-4,6-dimethylpyridazine;ethane?
The IUPAC name of 3-(3,5-difluorophenyl)-4,6-dimethylpyridazine;ethane (CID 143839774) is 3-(3,5-difluorophenyl)-4,6-dimethylpyridazine;ethane.
What is the SMILES notation for 3-(3,5-difluorophenyl)-4,6-dimethylpyridazine;ethane?
The canonical SMILES for 3-(3,5-difluorophenyl)-4,6-dimethylpyridazine;ethane is CC.Cc1cc(C)c(-c2cc(F)cc(F)c2)nn1.
What is the InChIKey of 3-(3,5-difluorophenyl)-4,6-dimethylpyridazine;ethane?
The InChIKey is CMGXMCSSOCCRFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F2N2.C2H6/c1-7-3-8(2)15-16-12(7)9-4-10(13)6-11(14)5-9;1-2/h3-6H,1-2H3;1-2H3.
What are the key properties of 3-(3,5-difluorophenyl)-4,6-dimethylpyridazine;ethane?
3-(3,5-difluorophenyl)-4,6-dimethylpyridazine;ethane has a molecular weight of 250.29 g/mol, XLogP of 4.06, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-difluorophenyl)-4,6-dimethylpyridazine;ethane is sourced from PubChem (CID 143839774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).