C19H28F2O5 — CID 143839990
[(5S,6S,11S)-6-ethyl-4,5-difluorooxy-9-methyl-8-oxo-2,3,4,4a,5,6,7,11,12,12a-decahydro-1H-benzo[10]annulen-11-yl] acetate (PubChem CID 143839990) has the molecular formula C19H28F2O5 and a molecular weight of 374.42 g/mol. Its IUPAC name is [(5S,6S,11S)-6-ethyl-4,5-difluorooxy-9-methyl-8-oxo-2,3,4,4a,5,6,7,11,12,12a-decahydro-1H-benzo[10]annulen-11-yl] acetate.
| Compound Name | [(5S,6S,11S)-6-ethyl-4,5-difluorooxy-9-methyl-8-oxo-2,3,4,4a,5,6,7,11,12,12a-decahydro-1H-benzo[10]annulen-11-yl] acetate |
|---|---|
| PubChem CID | 143839990 |
| Molecular Formula | C19H28F2O5 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | [(5S,6S,11S)-6-ethyl-4,5-difluorooxy-9-methyl-8-oxo-2,3,4,4a,5,6,7,11,12,12a-decahydro-1H-benzo[10]annulen-11-yl] acetate |
| SMILES | CC[C@H]1CC(=O)C(C)=C[C@@H](OC(C)=O)CC2CCCC(OF)C2C1OF |
| InChI | InChI=1S/C19H28F2O5/c1-4-13-10-16(23)11(2)8-15(24-12(3)22)9-14-6-5-7-17(25-20)18(14)19(13)26-21/h8,13-15,17-19H,4-7,9-10H2,1-3H3/t13-,14?,15+,17?,18?,19?/m0/s1 |
| InChIKey | AODQZTPAFDEUHR-IYPUMXKNSA-N |
| XLogP | 4.21 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |