C17H23ClKN3O — CID 143840147
potassium;2-[(2-chloro-6-methylquinoline-4-carbonyl)amino]ethyl-ethylazanide;ethane (PubChem CID 143840147) has the molecular formula C17H23ClKN3O and a molecular weight of 359.94 g/mol. Its IUPAC name is potassium;2-[(2-chloro-6-methylquinoline-4-carbonyl)amino]ethyl-ethylazanide;ethane.
| Compound Name | potassium;2-[(2-chloro-6-methylquinoline-4-carbonyl)amino]ethyl-ethylazanide;ethane |
|---|---|
| PubChem CID | 143840147 |
| Molecular Formula | C17H23ClKN3O |
| Molecular Weight | 359.94 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | potassium;2-[(2-chloro-6-methylquinoline-4-carbonyl)amino]ethyl-ethylazanide;ethane |
| SMILES | CC.CC[N-]CCNC(=O)c1cc(Cl)nc2ccc(C)cc12.[K+] |
| InChI | InChI=1S/C15H17ClN3O.C2H6.K/c1-3-17-6-7-18-15(20)12-9-14(16)19-13-5-4-10(2)8-11(12)13;1-2;/h4-5,8-9H,3,6-7H2,1-2H3,(H,18,20);1-2H3;/q-1;;+1 |
| InChIKey | FFCUSCDXAGXXJV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 56.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.94 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|