C18H23FN2O — CID 143841040
6-(2-aminoethyl)-1-(3-fluoropropyl)-2,3,4,9-tetrahydrobenzo[g]quinolin-8-one (PubChem CID 143841040) has the molecular formula C18H23FN2O and a molecular weight of 302.39 g/mol. Its IUPAC name is 6-(2-aminoethyl)-1-(3-fluoropropyl)-2,3,4,9-tetrahydrobenzo[g]quinolin-8-one.
| Compound Name | 6-(2-aminoethyl)-1-(3-fluoropropyl)-2,3,4,9-tetrahydrobenzo[g]quinolin-8-one |
|---|---|
| PubChem CID | 143841040 |
| Molecular Formula | C18H23FN2O |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 6-(2-aminoethyl)-1-(3-fluoropropyl)-2,3,4,9-tetrahydrobenzo[g]quinolin-8-one |
| SMILES | NCCC1=CC(=O)Cc2cc3c(cc21)CCCN3CCCF |
| InChI | InChI=1S/C18H23FN2O/c19-5-2-8-21-7-1-3-14-11-17-13(4-6-20)9-16(22)10-15(17)12-18(14)21/h9,11-12H,1-8,10,20H2 |
| InChIKey | VAYUKHWCQIDBDS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|