C20H31N3O3 — CID 143841761
2-[2-[(1'-cyclobutylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)amino]ethylamino]ethanol (PubChem CID 143841761) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is 2-[2-[(1'-cyclobutylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)amino]ethylamino]ethanol.
| Compound Name | 2-[2-[(1'-cyclobutylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)amino]ethylamino]ethanol |
|---|---|
| PubChem CID | 143841761 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 2-[2-[(1'-cyclobutylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)amino]ethylamino]ethanol |
| SMILES | OCCNCCNc1ccc2c(c1)COC1(CCN(C3CCC3)CC1)O2 |
| InChI | InChI=1S/C20H31N3O3/c24-13-10-21-8-9-22-17-4-5-19-16(14-17)15-25-20(26-19)6-11-23(12-7-20)18-2-1-3-18/h4-5,14,18,21-22,24H,1-3,6-13,15H2 |
| InChIKey | PKJKFZIIFXBXRC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 65.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|