About 2-methoxy-6-methylpyridine;3-methoxypyridine
2-methoxy-6-methylpyridine;3-methoxypyridine (PubChem CID 143842075) has the molecular formula C13H16N2O2
and a molecular weight of 232.28 g/mol. Its IUPAC name is 2-methoxy-6-methylpyridine;3-methoxypyridine.
Molecular Properties
| Compound Name | 2-methoxy-6-methylpyridine;3-methoxypyridine |
| PubChem CID | 143842075 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 2-methoxy-6-methylpyridine;3-methoxypyridine |
| SMILES | COc1cccc(C)n1.COc1cccnc1 |
| InChI | InChI=1S/C7H9NO.C6H7NO/c1-6-4-3-5-7(8-6)9-2;1-8-6-3-2-4-7-5-6/h3-5H,1-2H3;2-5H,1H3 |
| InChIKey | KMCNLTDMNVEPDM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxy-6-methylpyridine;3-methoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-6-methylpyridine;3-methoxypyridine?
The IUPAC name of 2-methoxy-6-methylpyridine;3-methoxypyridine (CID 143842075) is 2-methoxy-6-methylpyridine;3-methoxypyridine.
What is the SMILES notation for 2-methoxy-6-methylpyridine;3-methoxypyridine?
The canonical SMILES for 2-methoxy-6-methylpyridine;3-methoxypyridine is COc1cccc(C)n1.COc1cccnc1.
What is the InChIKey of 2-methoxy-6-methylpyridine;3-methoxypyridine?
The InChIKey is KMCNLTDMNVEPDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO.C6H7NO/c1-6-4-3-5-7(8-6)9-2;1-8-6-3-2-4-7-5-6/h3-5H,1-2H3;2-5H,1H3.
What are the key properties of 2-methoxy-6-methylpyridine;3-methoxypyridine?
2-methoxy-6-methylpyridine;3-methoxypyridine has a molecular weight of 232.28 g/mol, XLogP of 2.49, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-6-methylpyridine;3-methoxypyridine is sourced from PubChem (CID 143842075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).