C26H26Cl2F2N4OS — CID 143842305
2-amino-N-[2-(N-[1-[bis(4-chlorophenyl)methyl]azetidin-3-yl]-3,5-difluoroanilino)sulfanylethyl]acetamide (PubChem CID 143842305) has the molecular formula C26H26Cl2F2N4OS and a molecular weight of 551.49 g/mol. Its IUPAC name is 2-amino-N-[2-(N-[1-[bis(4-chlorophenyl)methyl]azetidin-3-yl]-3,5-difluoroanilino)sulfanylethyl]acetamide.
| Compound Name | 2-amino-N-[2-(N-[1-[bis(4-chlorophenyl)methyl]azetidin-3-yl]-3,5-difluoroanilino)sulfanylethyl]acetamide |
|---|---|
| PubChem CID | 143842305 |
| Molecular Formula | C26H26Cl2F2N4OS |
| Molecular Weight | 551.49 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | 2-amino-N-[2-(N-[1-[bis(4-chlorophenyl)methyl]azetidin-3-yl]-3,5-difluoroanilino)sulfanylethyl]acetamide |
| SMILES | NCC(=O)NCCSN(c1cc(F)cc(F)c1)C1CN(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C26H26Cl2F2N4OS/c27-19-5-1-17(2-6-19)26(18-3-7-20(28)8-4-18)33-15-24(16-33)34(36-10-9-32-25(35)14-31)23-12-21(29)11-22(30)13-23/h1-8,11-13,24,26H,9-10,14-16,31H2,(H,32,35) |
| InChIKey | VEBXUXPIDRJBRG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|