C21H28N4O4S — CID 143842456
N,N-diethyl-4-hydroxy-3-[(Z)-[2-[4-(2-hydroxyethyl)piperazin-1-yl]-4-oxo-1,3-thiazol-5-ylidene]methyl]benzamide (PubChem CID 143842456) has the molecular formula C21H28N4O4S and a molecular weight of 432.55 g/mol. Its IUPAC name is N,N-diethyl-4-hydroxy-3-[(Z)-[2-[4-(2-hydroxyethyl)piperazin-1-yl]-4-oxo-1,3-thiazol-5-ylidene]methyl]benzamide.
| Compound Name | N,N-diethyl-4-hydroxy-3-[(Z)-[2-[4-(2-hydroxyethyl)piperazin-1-yl]-4-oxo-1,3-thiazol-5-ylidene]methyl]benzamide |
|---|---|
| PubChem CID | 143842456 |
| Molecular Formula | C21H28N4O4S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | N,N-diethyl-4-hydroxy-3-[(Z)-[2-[4-(2-hydroxyethyl)piperazin-1-yl]-4-oxo-1,3-thiazol-5-ylidene]methyl]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(O)c(/C=C2\SC(N3CCN(CCO)CC3)=NC2=O)c1 |
| InChI | InChI=1S/C21H28N4O4S/c1-3-24(4-2)20(29)15-5-6-17(27)16(13-15)14-18-19(28)22-21(30-18)25-9-7-23(8-10-25)11-12-26/h5-6,13-14,26-27H,3-4,7-12H2,1-2H3/b18-14- |
| InChIKey | OWVVTDMTUJJOED-JXAWBTAJSA-N |
| XLogP | 1.45 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|