C21H29FN4O4S — CID 143842478
ethane;[4-fluoro-2-[(Z)-[2-[4-(2-hydroxyethyl)piperazin-1-yl]-4-oxo-1,3-thiazol-5-ylidene]methyl]phenyl] N,N-dimethylcarbamate (PubChem CID 143842478) has the molecular formula C21H29FN4O4S and a molecular weight of 452.55 g/mol. Its IUPAC name is ethane;[4-fluoro-2-[(Z)-[2-[4-(2-hydroxyethyl)piperazin-1-yl]-4-oxo-1,3-thiazol-5-ylidene]methyl]phenyl] N,N-dimethylcarbamate.
| Compound Name | ethane;[4-fluoro-2-[(Z)-[2-[4-(2-hydroxyethyl)piperazin-1-yl]-4-oxo-1,3-thiazol-5-ylidene]methyl]phenyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 143842478 |
| Molecular Formula | C21H29FN4O4S |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | ethane;[4-fluoro-2-[(Z)-[2-[4-(2-hydroxyethyl)piperazin-1-yl]-4-oxo-1,3-thiazol-5-ylidene]methyl]phenyl] N,N-dimethylcarbamate |
| SMILES | CC.CN(C)C(=O)Oc1ccc(F)cc1/C=C1\SC(N2CCN(CCO)CC2)=NC1=O |
| InChI | InChI=1S/C19H23FN4O4S.C2H6/c1-22(2)19(27)28-15-4-3-14(20)11-13(15)12-16-17(26)21-18(29-16)24-7-5-23(6-8-24)9-10-25;1-2/h3-4,11-12,25H,5-10H2,1-2H3;1-2H3/b16-12-; |
| InChIKey | KJCQPMCSAHGLIV-PXJKFVASSA-N |
| XLogP | 2.49 |
| TPSA | 85.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|