About ethane;propane;thieno[3,2-f][1]benzothiole-4,8-dione
ethane;propane;thieno[3,2-f][1]benzothiole-4,8-dione (PubChem CID 143843331) has the molecular formula C15H18O2S2
and a molecular weight of 294.44 g/mol. Its IUPAC name is ethane;propane;thieno[3,2-f][1]benzothiole-4,8-dione.
Molecular Properties
| Compound Name | ethane;propane;thieno[3,2-f][1]benzothiole-4,8-dione |
| PubChem CID | 143843331 |
| Molecular Formula | C15H18O2S2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | ethane;propane;thieno[3,2-f][1]benzothiole-4,8-dione |
| SMILES | CC.CCC.O=C1c2ccsc2C(=O)c2sccc21 |
| InChI | InChI=1S/C10H4O2S2.C3H8.C2H6/c11-7-5-1-3-13-9(5)8(12)10-6(7)2-4-14-10;1-3-2;1-2/h1-4H;3H2,1-2H3;1-2H3 |
| InChIKey | FJXRQZKOCYKTKE-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze ethane;propane;thieno[3,2-f][1]benzothiole-4,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;propane;thieno[3,2-f][1]benzothiole-4,8-dione?
The IUPAC name of ethane;propane;thieno[3,2-f][1]benzothiole-4,8-dione (CID 143843331) is ethane;propane;thieno[3,2-f][1]benzothiole-4,8-dione.
What is the SMILES notation for ethane;propane;thieno[3,2-f][1]benzothiole-4,8-dione?
The canonical SMILES for ethane;propane;thieno[3,2-f][1]benzothiole-4,8-dione is CC.CCC.O=C1c2ccsc2C(=O)c2sccc21.
What is the InChIKey of ethane;propane;thieno[3,2-f][1]benzothiole-4,8-dione?
The InChIKey is FJXRQZKOCYKTKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4O2S2.C3H8.C2H6/c11-7-5-1-3-13-9(5)8(12)10-6(7)2-4-14-10;1-3-2;1-2/h1-4H;3H2,1-2H3;1-2H3.
What are the key properties of ethane;propane;thieno[3,2-f][1]benzothiole-4,8-dione?
ethane;propane;thieno[3,2-f][1]benzothiole-4,8-dione has a molecular weight of 294.44 g/mol, XLogP of 5.03, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;propane;thieno[3,2-f][1]benzothiole-4,8-dione is sourced from PubChem (CID 143843331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).