C23H30N2O2S — CID 143843383
1-(9-amino-8-methoxy-1-thiophen-2-yl-5,6-dihydropyrrolo[2,1-a]isoquinolin-3-yl)ethanone;ethane (PubChem CID 143843383) has the molecular formula C23H30N2O2S and a molecular weight of 398.57 g/mol. Its IUPAC name is 1-(9-amino-8-methoxy-1-thiophen-2-yl-5,6-dihydropyrrolo[2,1-a]isoquinolin-3-yl)ethanone;ethane.
| Compound Name | 1-(9-amino-8-methoxy-1-thiophen-2-yl-5,6-dihydropyrrolo[2,1-a]isoquinolin-3-yl)ethanone;ethane |
|---|---|
| PubChem CID | 143843383 |
| Molecular Formula | C23H30N2O2S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 1-(9-amino-8-methoxy-1-thiophen-2-yl-5,6-dihydropyrrolo[2,1-a]isoquinolin-3-yl)ethanone;ethane |
| SMILES | CC.CC.COc1cc2c(cc1N)-c1c(-c3cccs3)cc(C(C)=O)n1CC2 |
| InChI | InChI=1S/C19H18N2O2S.2C2H6/c1-11(22)16-10-14(18-4-3-7-24-18)19-13-9-15(20)17(23-2)8-12(13)5-6-21(16)19;2*1-2/h3-4,7-10H,5-6,20H2,1-2H3;2*1-2H3 |
| InChIKey | JPZANBWEYHHWSL-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|