C15H6F18O3 — CID 14384432
2-[3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 14384432) has the molecular formula C15H6F18O3 and a molecular weight of 576.17 g/mol. Its IUPAC name is 2-[3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 14384432 |
| Molecular Formula | C15H6F18O3 |
| Molecular Weight | 576.17 g/mol |
| Exact Mass | 576.00 |
| IUPAC Name | 2-[3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(c1cc(C(O)(C(F)(F)F)C(F)(F)F)cc(C(O)(C(F)(F)F)C(F)(F)F)c1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H6F18O3/c16-10(17,18)7(34,11(19,20)21)4-1-5(8(35,12(22,23)24)13(25,26)27)3-6(2-4)9(36,14(28,29)30)15(31,32)33/h1-3,34-36H |
| InChIKey | ZWGOOKDSFOIXID-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.17 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |