About N-hex-5-enyl-N-methylformamide;methylcyclopropane;propan-2-one
N-hex-5-enyl-N-methylformamide;methylcyclopropane;propan-2-one (PubChem CID 143844745) has the molecular formula C15H29NO2
and a molecular weight of 255.40 g/mol. Its IUPAC name is N-hex-5-enyl-N-methylformamide;methylcyclopropane;propan-2-one.
Molecular Properties
| Compound Name | N-hex-5-enyl-N-methylformamide;methylcyclopropane;propan-2-one |
| PubChem CID | 143844745 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | N-hex-5-enyl-N-methylformamide;methylcyclopropane;propan-2-one |
| SMILES | C=CCCCCN(C)C=O.CC(C)=O.CC1CC1 |
| InChI | InChI=1S/C8H15NO.C4H8.C3H6O/c1-3-4-5-6-7-9(2)8-10;1-4-2-3-4;1-3(2)4/h3,8H,1,4-7H2,2H3;4H,2-3H2,1H3;1-2H3 |
| InChIKey | ADZYMMDYTKNGQC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-hex-5-enyl-N-methylformamide;methylcyclopropane;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hex-5-enyl-N-methylformamide;methylcyclopropane;propan-2-one?
The IUPAC name of N-hex-5-enyl-N-methylformamide;methylcyclopropane;propan-2-one (CID 143844745) is N-hex-5-enyl-N-methylformamide;methylcyclopropane;propan-2-one.
What is the SMILES notation for N-hex-5-enyl-N-methylformamide;methylcyclopropane;propan-2-one?
The canonical SMILES for N-hex-5-enyl-N-methylformamide;methylcyclopropane;propan-2-one is C=CCCCCN(C)C=O.CC(C)=O.CC1CC1.
What is the InChIKey of N-hex-5-enyl-N-methylformamide;methylcyclopropane;propan-2-one?
The InChIKey is ADZYMMDYTKNGQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO.C4H8.C3H6O/c1-3-4-5-6-7-9(2)8-10;1-4-2-3-4;1-3(2)4/h3,8H,1,4-7H2,2H3;4H,2-3H2,1H3;1-2H3.
What are the key properties of N-hex-5-enyl-N-methylformamide;methylcyclopropane;propan-2-one?
N-hex-5-enyl-N-methylformamide;methylcyclopropane;propan-2-one has a molecular weight of 255.40 g/mol, XLogP of 3.44, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-hex-5-enyl-N-methylformamide;methylcyclopropane;propan-2-one is sourced from PubChem (CID 143844745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).