C29H33N5OS — CID 143844956
N-[2-(3-ethylimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]quinoline-8-carboxamide;N-propylpropan-1-amine (PubChem CID 143844956) has the molecular formula C29H33N5OS and a molecular weight of 499.68 g/mol. Its IUPAC name is N-[2-(3-ethylimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]quinoline-8-carboxamide;N-propylpropan-1-amine.
| Compound Name | N-[2-(3-ethylimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]quinoline-8-carboxamide;N-propylpropan-1-amine |
|---|---|
| PubChem CID | 143844956 |
| Molecular Formula | C29H33N5OS |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | N-[2-(3-ethylimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]quinoline-8-carboxamide;N-propylpropan-1-amine |
| SMILES | CCCNCCC.CCc1csc2nc(-c3ccccc3NC(=O)c3cccc4cccnc34)cn12 |
| InChI | InChI=1S/C23H18N4OS.C6H15N/c1-2-16-14-29-23-26-20(13-27(16)23)17-9-3-4-11-19(17)25-22(28)18-10-5-7-15-8-6-12-24-21(15)18;1-3-5-7-6-4-2/h3-14H,2H2,1H3,(H,25,28);7H,3-6H2,1-2H3 |
| InChIKey | BIIFFTHKGYPCIY-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|