C15H23F2NO — CID 143845401
azepane;2,4-difluorobenzaldehyde;ethane (PubChem CID 143845401) has the molecular formula C15H23F2NO and a molecular weight of 271.35 g/mol. Its IUPAC name is azepane;2,4-difluorobenzaldehyde;ethane.
| Compound Name | azepane;2,4-difluorobenzaldehyde;ethane |
|---|---|
| PubChem CID | 143845401 |
| Molecular Formula | C15H23F2NO |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | azepane;2,4-difluorobenzaldehyde;ethane |
| SMILES | C1CCCNCC1.CC.O=Cc1ccc(F)cc1F |
| InChI | InChI=1S/C7H4F2O.C6H13N.C2H6/c8-6-2-1-5(4-10)7(9)3-6;1-2-4-6-7-5-3-1;1-2/h1-4H;7H,1-6H2;1-2H3 |
| InChIKey | GYCPITNFSNXMBJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|