C17H24BF3N2O3 — CID 143845422
1-ethyl-1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 143845422) has the molecular formula C17H24BF3N2O3 and a molecular weight of 372.20 g/mol. Its IUPAC name is 1-ethyl-1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 1-ethyl-1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 143845422 |
| Molecular Formula | C17H24BF3N2O3 |
| Molecular Weight | 372.20 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 1-ethyl-1-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | CCN(Cc1cc(C(F)(F)F)ccc1B1OC(C)(C)C(C)(C)O1)C(N)=O |
| InChI | InChI=1S/C17H24BF3N2O3/c1-6-23(14(22)24)10-11-9-12(17(19,20)21)7-8-13(11)18-25-15(2,3)16(4,5)26-18/h7-9H,6,10H2,1-5H3,(H2,22,24) |
| InChIKey | VHNXTBBGDJOUBH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.20 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|