C31H31FN8O2 — CID 143846783
6-(cyclohexylamino)-N-(2-fluoro-4-pyridinyl)-8-[(4-methoxyphenyl)methyl-pyridin-2-ylamino]imidazo[1,2-b]pyridazine-3-carboxamide (PubChem CID 143846783) has the molecular formula C31H31FN8O2 and a molecular weight of 566.64 g/mol. Its IUPAC name is 6-(cyclohexylamino)-N-(2-fluoro-4-pyridinyl)-8-[(4-methoxyphenyl)methyl-pyridin-2-ylamino]imidazo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | 6-(cyclohexylamino)-N-(2-fluoro-4-pyridinyl)-8-[(4-methoxyphenyl)methyl-pyridin-2-ylamino]imidazo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 143846783 |
| Molecular Formula | C31H31FN8O2 |
| Molecular Weight | 566.64 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | 6-(cyclohexylamino)-N-(2-fluoro-4-pyridinyl)-8-[(4-methoxyphenyl)methyl-pyridin-2-ylamino]imidazo[1,2-b]pyridazine-3-carboxamide |
| SMILES | COc1ccc(CN(c2ccccn2)c2cc(NC3CCCCC3)nn3c(C(=O)Nc4ccnc(F)c4)cnc23)cc1 |
| InChI | InChI=1S/C31H31FN8O2/c1-42-24-12-10-21(11-13-24)20-39(29-9-5-6-15-34-29)25-18-28(36-22-7-3-2-4-8-22)38-40-26(19-35-30(25)40)31(41)37-23-14-16-33-27(32)17-23/h5-6,9-19,22H,2-4,7-8,20H2,1H3,(H,36,38)(H,33,37,41) |
| InChIKey | FYWXTSOWBWOMTR-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.64 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|