About (1S,6R)-7,7-difluoro-3-methylbicyclo[4.1.0]heptane
(1S,6R)-7,7-difluoro-3-methylbicyclo[4.1.0]heptane (PubChem CID 143846852) has the molecular formula C8H12F2
and a molecular weight of 146.18 g/mol. Its IUPAC name is (1S,6R)-7,7-difluoro-3-methylbicyclo[4.1.0]heptane.
Molecular Properties
| Compound Name | (1S,6R)-7,7-difluoro-3-methylbicyclo[4.1.0]heptane |
| PubChem CID | 143846852 |
| Molecular Formula | C8H12F2 |
| Molecular Weight | 146.18 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | (1S,6R)-7,7-difluoro-3-methylbicyclo[4.1.0]heptane |
| SMILES | CC1CC[C@@H]2[C@H](C1)C2(F)F |
| InChI | InChI=1S/C8H12F2/c1-5-2-3-6-7(4-5)8(6,9)10/h5-7H,2-4H2,1H3/t5?,6-,7+/m1/s1 |
| InChIKey | HXBGFMYCBVSVPR-FWPZAIACSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.18 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (1S,6R)-7,7-difluoro-3-methylbicyclo[4.1.0]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,6R)-7,7-difluoro-3-methylbicyclo[4.1.0]heptane?
The IUPAC name of (1S,6R)-7,7-difluoro-3-methylbicyclo[4.1.0]heptane (CID 143846852) is (1S,6R)-7,7-difluoro-3-methylbicyclo[4.1.0]heptane.
What is the SMILES notation for (1S,6R)-7,7-difluoro-3-methylbicyclo[4.1.0]heptane?
The canonical SMILES for (1S,6R)-7,7-difluoro-3-methylbicyclo[4.1.0]heptane is CC1CC[C@@H]2[C@H](C1)C2(F)F.
What is the InChIKey of (1S,6R)-7,7-difluoro-3-methylbicyclo[4.1.0]heptane?
The InChIKey is HXBGFMYCBVSVPR-FWPZAIACSA-N. The full InChI is InChI=1S/C8H12F2/c1-5-2-3-6-7(4-5)8(6,9)10/h5-7H,2-4H2,1H3/t5?,6-,7+/m1/s1.
What are the key properties of (1S,6R)-7,7-difluoro-3-methylbicyclo[4.1.0]heptane?
(1S,6R)-7,7-difluoro-3-methylbicyclo[4.1.0]heptane has a molecular weight of 146.18 g/mol, XLogP of 2.69, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,6R)-7,7-difluoro-3-methylbicyclo[4.1.0]heptane is sourced from PubChem (CID 143846852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).