C32H54 — CID 143847248
(1R,2R,5S,7S,10S,11R,14R,16R,21S)-1,2,6,6,7,10-hexamethyl-16-prop-1-en-2-ylpentacyclo[12.9.0.02,11.05,10.015,21]tricosane (PubChem CID 143847248) has the molecular formula C32H54 and a molecular weight of 438.78 g/mol. Its IUPAC name is (1R,2R,5S,7S,10S,11R,14R,16R,21S)-1,2,6,6,7,10-hexamethyl-16-prop-1-en-2-ylpentacyclo[12.9.0.02,11.05,10.015,21]tricosane.
| Compound Name | (1R,2R,5S,7S,10S,11R,14R,16R,21S)-1,2,6,6,7,10-hexamethyl-16-prop-1-en-2-ylpentacyclo[12.9.0.02,11.05,10.015,21]tricosane |
|---|---|
| PubChem CID | 143847248 |
| Molecular Formula | C32H54 |
| Molecular Weight | 438.78 g/mol |
| Exact Mass | 438.42 |
| IUPAC Name | (1R,2R,5S,7S,10S,11R,14R,16R,21S)-1,2,6,6,7,10-hexamethyl-16-prop-1-en-2-ylpentacyclo[12.9.0.02,11.05,10.015,21]tricosane |
| SMILES | C=C(C)C1CCCC[C@H]2CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](C)C(C)(C)[C@@H]5CC[C@]43C)C12 |
| InChI | InChI=1S/C32H54/c1-21(2)24-12-10-9-11-23-16-19-31(7)25(28(23)24)13-14-27-30(6)18-15-22(3)29(4,5)26(30)17-20-32(27,31)8/h22-28H,1,9-20H2,2-8H3/t22-,23-,24?,25+,26-,27+,28?,30-,31+,32+/m0/s1 |
| InChIKey | KTBDUFIOWPWSEV-ZVKNIERDSA-N |
| XLogP | 9.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.78 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|