C21H25ClF2O4 — CID 143847525
2-[4-chloro-3-[(4-ethylphenyl)methyl]phenyl]-2-(3,3-difluoro-1-hydroxybutan-2-yl)oxyethane-1,1-diol (PubChem CID 143847525) has the molecular formula C21H25ClF2O4 and a molecular weight of 414.88 g/mol. Its IUPAC name is 2-[4-chloro-3-[(4-ethylphenyl)methyl]phenyl]-2-(3,3-difluoro-1-hydroxybutan-2-yl)oxyethane-1,1-diol.
| Compound Name | 2-[4-chloro-3-[(4-ethylphenyl)methyl]phenyl]-2-(3,3-difluoro-1-hydroxybutan-2-yl)oxyethane-1,1-diol |
|---|---|
| PubChem CID | 143847525 |
| Molecular Formula | C21H25ClF2O4 |
| Molecular Weight | 414.88 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 2-[4-chloro-3-[(4-ethylphenyl)methyl]phenyl]-2-(3,3-difluoro-1-hydroxybutan-2-yl)oxyethane-1,1-diol |
| SMILES | CCc1ccc(Cc2cc(C(OC(CO)C(C)(F)F)C(O)O)ccc2Cl)cc1 |
| InChI | InChI=1S/C21H25ClF2O4/c1-3-13-4-6-14(7-5-13)10-16-11-15(8-9-17(16)22)19(20(26)27)28-18(12-25)21(2,23)24/h4-9,11,18-20,25-27H,3,10,12H2,1-2H3 |
| InChIKey | GVDNZJPPJSZAQY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.88 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|