C17H28FNO — CID 143848007
(Z)-1-(1,2-dimethyl-6-methylidenepiperidin-4-yl)-4-fluoro-3-[(Z)-prop-1-enyl]hex-3-en-2-ol (PubChem CID 143848007) has the molecular formula C17H28FNO and a molecular weight of 281.42 g/mol. Its IUPAC name is (Z)-1-(1,2-dimethyl-6-methylidenepiperidin-4-yl)-4-fluoro-3-[(Z)-prop-1-enyl]hex-3-en-2-ol.
| Compound Name | (Z)-1-(1,2-dimethyl-6-methylidenepiperidin-4-yl)-4-fluoro-3-[(Z)-prop-1-enyl]hex-3-en-2-ol |
|---|---|
| PubChem CID | 143848007 |
| Molecular Formula | C17H28FNO |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | (Z)-1-(1,2-dimethyl-6-methylidenepiperidin-4-yl)-4-fluoro-3-[(Z)-prop-1-enyl]hex-3-en-2-ol |
| SMILES | C=C1CC(CC(O)C(/C=C\C)=C(\F)CC)CC(C)N1C |
| InChI | InChI=1S/C17H28FNO/c1-6-8-15(16(18)7-2)17(20)11-14-9-12(3)19(5)13(4)10-14/h6,8,13-14,17,20H,3,7,9-11H2,1-2,4-5H3/b8-6-,16-15- |
| InChIKey | CARANSQTHGSUIG-RALUNSANSA-N |
| XLogP | 4.19 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|