C24H43FN4O3 — CID 143848010
ethane;2-[3-[2-ethyl-4-[[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]oxymethyl]-6-methylpiperidin-1-yl]-2-hydroxypropyl]-4,5-dimethyl-1,2,4-triazol-3-one (PubChem CID 143848010) has the molecular formula C24H43FN4O3 and a molecular weight of 454.63 g/mol. Its IUPAC name is ethane;2-[3-[2-ethyl-4-[[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]oxymethyl]-6-methylpiperidin-1-yl]-2-hydroxypropyl]-4,5-dimethyl-1,2,4-triazol-3-one.
| Compound Name | ethane;2-[3-[2-ethyl-4-[[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]oxymethyl]-6-methylpiperidin-1-yl]-2-hydroxypropyl]-4,5-dimethyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 143848010 |
| Molecular Formula | C24H43FN4O3 |
| Molecular Weight | 454.63 g/mol |
| Exact Mass | 454.33 |
| IUPAC Name | ethane;2-[3-[2-ethyl-4-[[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]oxymethyl]-6-methylpiperidin-1-yl]-2-hydroxypropyl]-4,5-dimethyl-1,2,4-triazol-3-one |
| SMILES | C/C=C\C(OCC1CC(C)N(CC(O)Cn2nc(C)n(C)c2=O)C(CC)C1)=C(/C)F.CC |
| InChI | InChI=1S/C22H37FN4O3.C2H6/c1-7-9-21(16(4)23)30-14-18-10-15(3)26(19(8-2)11-18)12-20(28)13-27-22(29)25(6)17(5)24-27;1-2/h7,9,15,18-20,28H,8,10-14H2,1-6H3;1-2H3/b9-7-,21-16-; |
| InChIKey | RSAZXYYPHQKORA-ZJTFNULZSA-N |
| XLogP | 3.95 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.63 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|