C11H14N2O — CID 143848949
5,6-bis(ethenyl)-1,3-dimethyl-2H-1,4-diazepin-7-one (PubChem CID 143848949) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 5,6-bis(ethenyl)-1,3-dimethyl-2H-1,4-diazepin-7-one.
| Compound Name | 5,6-bis(ethenyl)-1,3-dimethyl-2H-1,4-diazepin-7-one |
|---|---|
| PubChem CID | 143848949 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 5,6-bis(ethenyl)-1,3-dimethyl-2H-1,4-diazepin-7-one |
| SMILES | C=CC1=C(C=C)C(=O)N(C)CC(C)=N1 |
| InChI | InChI=1S/C11H14N2O/c1-5-9-10(6-2)12-8(3)7-13(4)11(9)14/h5-6H,1-2,7H2,3-4H3 |
| InChIKey | WIIZJIOVTWGQRQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |