About 1-(4-bromophenyl)pentan-1-one;2-fluoropropane
1-(4-bromophenyl)pentan-1-one;2-fluoropropane (PubChem CID 143849337) has the molecular formula C14H20BrFO
and a molecular weight of 303.22 g/mol. Its IUPAC name is 1-(4-bromophenyl)pentan-1-one;2-fluoropropane.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)pentan-1-one;2-fluoropropane |
| PubChem CID | 143849337 |
| Molecular Formula | C14H20BrFO |
| Molecular Weight | 303.22 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 1-(4-bromophenyl)pentan-1-one;2-fluoropropane |
| SMILES | CC(C)F.CCCCC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H13BrO.C3H7F/c1-2-3-4-11(13)9-5-7-10(12)8-6-9;1-3(2)4/h5-8H,2-4H2,1H3;3H,1-2H3 |
| InChIKey | OPRHSFBBNWPHPR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.22 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-bromophenyl)pentan-1-one;2-fluoropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)pentan-1-one;2-fluoropropane?
The IUPAC name of 1-(4-bromophenyl)pentan-1-one;2-fluoropropane (CID 143849337) is 1-(4-bromophenyl)pentan-1-one;2-fluoropropane.
What is the SMILES notation for 1-(4-bromophenyl)pentan-1-one;2-fluoropropane?
The canonical SMILES for 1-(4-bromophenyl)pentan-1-one;2-fluoropropane is CC(C)F.CCCCC(=O)c1ccc(Br)cc1.
What is the InChIKey of 1-(4-bromophenyl)pentan-1-one;2-fluoropropane?
The InChIKey is OPRHSFBBNWPHPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrO.C3H7F/c1-2-3-4-11(13)9-5-7-10(12)8-6-9;1-3(2)4/h5-8H,2-4H2,1H3;3H,1-2H3.
What are the key properties of 1-(4-bromophenyl)pentan-1-one;2-fluoropropane?
1-(4-bromophenyl)pentan-1-one;2-fluoropropane has a molecular weight of 303.22 g/mol, XLogP of 5.19, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)pentan-1-one;2-fluoropropane is sourced from PubChem (CID 143849337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).