C24H35FN4O2S — CID 143849725
N-carbamoyl-2-[(5-fluoro-2-pyridinyl)amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanamide (PubChem CID 143849725) has the molecular formula C24H35FN4O2S and a molecular weight of 462.64 g/mol. Its IUPAC name is N-carbamoyl-2-[(5-fluoro-2-pyridinyl)amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanamide.
| Compound Name | N-carbamoyl-2-[(5-fluoro-2-pyridinyl)amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 143849725 |
| Molecular Formula | C24H35FN4O2S |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | N-carbamoyl-2-[(5-fluoro-2-pyridinyl)amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanamide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSCC(Nc1ccc(F)cn1)C(=O)NC(N)=O |
| InChI | InChI=1S/C24H35FN4O2S/c1-17(2)7-5-8-18(3)9-6-10-19(4)13-14-32-16-21(23(30)29-24(26)31)28-22-12-11-20(25)15-27-22/h7,9,11-13,15,21H,5-6,8,10,14,16H2,1-4H3,(H,27,28)(H3,26,29,30,31)/b18-9+,19-13+ |
| InChIKey | ZJTKRXCEIYWLMJ-RPSHFMPKSA-N |
| XLogP | 5.35 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|