C24H33N3O2 — CID 143849916
ethane;methyl 9-[3-(2-ethylimidazol-1-yl)propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate (PubChem CID 143849916) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is ethane;methyl 9-[3-(2-ethylimidazol-1-yl)propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate.
| Compound Name | ethane;methyl 9-[3-(2-ethylimidazol-1-yl)propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
|---|---|
| PubChem CID | 143849916 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | ethane;methyl 9-[3-(2-ethylimidazol-1-yl)propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
| SMILES | CC.CCc1nccn1CCCn1c2c(c3cc(C(=O)OC)ccc31)CCCC2 |
| InChI | InChI=1S/C22H27N3O2.C2H6/c1-3-21-23-11-14-24(21)12-6-13-25-19-8-5-4-7-17(19)18-15-16(22(26)27-2)9-10-20(18)25;1-2/h9-11,14-15H,3-8,12-13H2,1-2H3;1-2H3 |
| InChIKey | KVQZAHOQMMHHBY-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|