C26H30N2O4 — CID 143849921
methyl 9-[3-[(6-formylcyclohexa-2,4-diene-1-carbonyl)-methylamino]propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate (PubChem CID 143849921) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is methyl 9-[3-[(6-formylcyclohexa-2,4-diene-1-carbonyl)-methylamino]propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate.
| Compound Name | methyl 9-[3-[(6-formylcyclohexa-2,4-diene-1-carbonyl)-methylamino]propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
|---|---|
| PubChem CID | 143849921 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | methyl 9-[3-[(6-formylcyclohexa-2,4-diene-1-carbonyl)-methylamino]propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c1c(n2CCCN(C)C(=O)C2C=CC=CC2C=O)CCCC1 |
| InChI | InChI=1S/C26H30N2O4/c1-27(25(30)20-9-4-3-8-19(20)17-29)14-7-15-28-23-11-6-5-10-21(23)22-16-18(26(31)32-2)12-13-24(22)28/h3-4,8-9,12-13,16-17,19-20H,5-7,10-11,14-15H2,1-2H3 |
| InChIKey | BCNGKMMURGBMQG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|