About 3,5-dichloro-N-(3,4-dichlorophenyl)-2-hydroxybenzamide
3,5-dichloro-N-(3,4-dichlorophenyl)-2-hydroxybenzamide (PubChem CID 14385) has the molecular formula C13H7Cl4NO2
and a molecular weight of 351.02 g/mol. Its IUPAC name is 3,5-dichloro-N-(3,4-dichlorophenyl)-2-hydroxybenzamide.
Molecular Properties
| Compound Name | 3,5-dichloro-N-(3,4-dichlorophenyl)-2-hydroxybenzamide |
| PubChem CID | 14385 |
| Molecular Formula | C13H7Cl4NO2 |
| Molecular Weight | 351.02 g/mol |
| Exact Mass | 348.92 |
| IUPAC Name | 3,5-dichloro-N-(3,4-dichlorophenyl)-2-hydroxybenzamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C13H7Cl4NO2/c14-6-3-8(12(19)11(17)4-6)13(20)18-7-1-2-9(15)10(16)5-7/h1-5,19H,(H,18,20) |
| InChIKey | SJQBHPJLLIJASD-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.02 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dichloro-N-(3,4-dichlorophenyl)-2-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-N-(3,4-dichlorophenyl)-2-hydroxybenzamide?
The IUPAC name of 3,5-dichloro-N-(3,4-dichlorophenyl)-2-hydroxybenzamide (CID 14385) is 3,5-dichloro-N-(3,4-dichlorophenyl)-2-hydroxybenzamide.
What is the SMILES notation for 3,5-dichloro-N-(3,4-dichlorophenyl)-2-hydroxybenzamide?
The canonical SMILES for 3,5-dichloro-N-(3,4-dichlorophenyl)-2-hydroxybenzamide is O=C(Nc1ccc(Cl)c(Cl)c1)c1cc(Cl)cc(Cl)c1O.
What is the InChIKey of 3,5-dichloro-N-(3,4-dichlorophenyl)-2-hydroxybenzamide?
The InChIKey is SJQBHPJLLIJASD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7Cl4NO2/c14-6-3-8(12(19)11(17)4-6)13(20)18-7-1-2-9(15)10(16)5-7/h1-5,19H,(H,18,20).
What are the key properties of 3,5-dichloro-N-(3,4-dichlorophenyl)-2-hydroxybenzamide?
3,5-dichloro-N-(3,4-dichlorophenyl)-2-hydroxybenzamide has a molecular weight of 351.02 g/mol, XLogP of 5.26, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-N-(3,4-dichlorophenyl)-2-hydroxybenzamide is sourced from PubChem (CID 14385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).