C25H34F2N4O3 — CID 143850025
7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-5-amino-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid;pentane (PubChem CID 143850025) has the molecular formula C25H34F2N4O3 and a molecular weight of 476.57 g/mol. Its IUPAC name is 7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-5-amino-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid;pentane.
| Compound Name | 7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-5-amino-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid;pentane |
|---|---|
| PubChem CID | 143850025 |
| Molecular Formula | C25H34F2N4O3 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | 7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-5-amino-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid;pentane |
| SMILES | CCCCC.Nc1c(F)c(N2CC3CCCNC3C2)c(F)c2c1c(=O)c(C(=O)O)cn2C1CC1 |
| InChI | InChI=1S/C20H22F2N4O3.C5H12/c21-14-16(23)13-17(26(10-3-4-10)7-11(19(13)27)20(28)29)15(22)18(14)25-6-9-2-1-5-24-12(9)8-25;1-3-5-4-2/h7,9-10,12,24H,1-6,8,23H2,(H,28,29);3-5H2,1-2H3 |
| InChIKey | CLLCLPHPGJRANP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 100.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|