About 4-[3-(6-fluoro-3-pyridinyl)phenyl]-4-(4-methoxyphenyl)-5H-1,3-oxazol-2-amine;propane
4-[3-(6-fluoro-3-pyridinyl)phenyl]-4-(4-methoxyphenyl)-5H-1,3-oxazol-2-amine;propane (PubChem CID 143850368) has the molecular formula C24H26FN3O2
and a molecular weight of 407.49 g/mol. Its IUPAC name is 4-[3-(6-fluoro-3-pyridinyl)phenyl]-4-(4-methoxyphenyl)-5H-1,3-oxazol-2-amine;propane.
Molecular Properties
| Compound Name | 4-[3-(6-fluoro-3-pyridinyl)phenyl]-4-(4-methoxyphenyl)-5H-1,3-oxazol-2-amine;propane |
| PubChem CID | 143850368 |
| Molecular Formula | C24H26FN3O2 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 4-[3-(6-fluoro-3-pyridinyl)phenyl]-4-(4-methoxyphenyl)-5H-1,3-oxazol-2-amine;propane |
| SMILES | CCC.COc1ccc(C2(c3cccc(-c4ccc(F)nc4)c3)COC(N)=N2)cc1 |
| InChI | InChI=1S/C21H18FN3O2.C3H8/c1-26-18-8-6-16(7-9-18)21(13-27-20(23)25-21)17-4-2-3-14(11-17)15-5-10-19(22)24-12-15;1-3-2/h2-12H,13H2,1H3,(H2,23,25);3H2,1-2H3 |
| InChIKey | CMTMDJYUYNWISB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(6-fluoro-3-pyridinyl)phenyl]-4-(4-methoxyphenyl)-5H-1,3-oxazol-2-amine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(6-fluoro-3-pyridinyl)phenyl]-4-(4-methoxyphenyl)-5H-1,3-oxazol-2-amine;propane?
The IUPAC name of 4-[3-(6-fluoro-3-pyridinyl)phenyl]-4-(4-methoxyphenyl)-5H-1,3-oxazol-2-amine;propane (CID 143850368) is 4-[3-(6-fluoro-3-pyridinyl)phenyl]-4-(4-methoxyphenyl)-5H-1,3-oxazol-2-amine;propane.
What is the SMILES notation for 4-[3-(6-fluoro-3-pyridinyl)phenyl]-4-(4-methoxyphenyl)-5H-1,3-oxazol-2-amine;propane?
The canonical SMILES for 4-[3-(6-fluoro-3-pyridinyl)phenyl]-4-(4-methoxyphenyl)-5H-1,3-oxazol-2-amine;propane is CCC.COc1ccc(C2(c3cccc(-c4ccc(F)nc4)c3)COC(N)=N2)cc1.
What is the InChIKey of 4-[3-(6-fluoro-3-pyridinyl)phenyl]-4-(4-methoxyphenyl)-5H-1,3-oxazol-2-amine;propane?
The InChIKey is CMTMDJYUYNWISB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18FN3O2.C3H8/c1-26-18-8-6-16(7-9-18)21(13-27-20(23)25-21)17-4-2-3-14(11-17)15-5-10-19(22)24-12-15;1-3-2/h2-12H,13H2,1H3,(H2,23,25);3H2,1-2H3.
What are the key properties of 4-[3-(6-fluoro-3-pyridinyl)phenyl]-4-(4-methoxyphenyl)-5H-1,3-oxazol-2-amine;propane?
4-[3-(6-fluoro-3-pyridinyl)phenyl]-4-(4-methoxyphenyl)-5H-1,3-oxazol-2-amine;propane has a molecular weight of 407.49 g/mol, XLogP of 4.90, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(6-fluoro-3-pyridinyl)phenyl]-4-(4-methoxyphenyl)-5H-1,3-oxazol-2-amine;propane is sourced from PubChem (CID 143850368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).