About 1-butylimidazole-4,5-diol
1-butylimidazole-4,5-diol (PubChem CID 143850613) has the molecular formula C7H12N2O2
and a molecular weight of 156.19 g/mol. Its IUPAC name is 1-butylimidazole-4,5-diol.
Molecular Properties
| Compound Name | 1-butylimidazole-4,5-diol |
| PubChem CID | 143850613 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 1-butylimidazole-4,5-diol |
| SMILES | CCCCn1cnc(O)c1O |
| InChI | InChI=1S/C7H12N2O2/c1-2-3-4-9-5-8-6(10)7(9)11/h5,10-11H,2-4H2,1H3 |
| InChIKey | PGPWTQKVPOEQQJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-butylimidazole-4,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylimidazole-4,5-diol?
The IUPAC name of 1-butylimidazole-4,5-diol (CID 143850613) is 1-butylimidazole-4,5-diol.
What is the SMILES notation for 1-butylimidazole-4,5-diol?
The canonical SMILES for 1-butylimidazole-4,5-diol is CCCCn1cnc(O)c1O.
What is the InChIKey of 1-butylimidazole-4,5-diol?
The InChIKey is PGPWTQKVPOEQQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2/c1-2-3-4-9-5-8-6(10)7(9)11/h5,10-11H,2-4H2,1H3.
What are the key properties of 1-butylimidazole-4,5-diol?
1-butylimidazole-4,5-diol has a molecular weight of 156.19 g/mol, XLogP of 1.09, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylimidazole-4,5-diol is sourced from PubChem (CID 143850613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).