C37H40N2 — CID 143850704
9-[3-(2-cyclohexa-2,4-dien-1-yl-6-cyclohex-3-en-1-yl-2,3-dihydropyridin-4-yl)cyclohexa-2,4-dien-1-yl]-6-ethenyl-1,2,4b,8a-tetrahydrocarbazole (PubChem CID 143850704) has the molecular formula C37H40N2 and a molecular weight of 512.74 g/mol. Its IUPAC name is 9-[3-(2-cyclohexa-2,4-dien-1-yl-6-cyclohex-3-en-1-yl-2,3-dihydropyridin-4-yl)cyclohexa-2,4-dien-1-yl]-6-ethenyl-1,2,4b,8a-tetrahydrocarbazole.
| Compound Name | 9-[3-(2-cyclohexa-2,4-dien-1-yl-6-cyclohex-3-en-1-yl-2,3-dihydropyridin-4-yl)cyclohexa-2,4-dien-1-yl]-6-ethenyl-1,2,4b,8a-tetrahydrocarbazole |
|---|---|
| PubChem CID | 143850704 |
| Molecular Formula | C37H40N2 |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 512.32 |
| IUPAC Name | 9-[3-(2-cyclohexa-2,4-dien-1-yl-6-cyclohex-3-en-1-yl-2,3-dihydropyridin-4-yl)cyclohexa-2,4-dien-1-yl]-6-ethenyl-1,2,4b,8a-tetrahydrocarbazole |
| SMILES | C=CC1=CC2C3=C(CCC=C3)N(C3C=C(C4=CC(C5CC=CCC5)=NC(C5C=CC=CC5)C4)C=CC3)C2C=C1 |
| InChI | InChI=1S/C37H40N2/c1-2-26-20-21-37-33(22-26)32-18-9-10-19-36(32)39(37)31-17-11-16-29(23-31)30-24-34(27-12-5-3-6-13-27)38-35(25-30)28-14-7-4-8-15-28/h2-7,9,11-12,16,18,20-23,25,27-28,31,33-34,37H,1,8,10,13-15,17,19,24H2 |
| InChIKey | BAAHAUZFRFREED-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|