About 3-methoxy-5,7-dimethyl-3,5-dihydro-2H-1,4-dithiepine
3-methoxy-5,7-dimethyl-3,5-dihydro-2H-1,4-dithiepine (PubChem CID 143850717) has the molecular formula C8H14OS2
and a molecular weight of 190.33 g/mol. Its IUPAC name is 3-methoxy-5,7-dimethyl-3,5-dihydro-2H-1,4-dithiepine.
Analyze 3-methoxy-5,7-dimethyl-3,5-dihydro-2H-1,4-dithiepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-5,7-dimethyl-3,5-dihydro-2H-1,4-dithiepine?
The IUPAC name of 3-methoxy-5,7-dimethyl-3,5-dihydro-2H-1,4-dithiepine (CID 143850717) is 3-methoxy-5,7-dimethyl-3,5-dihydro-2H-1,4-dithiepine.
What is the SMILES notation for 3-methoxy-5,7-dimethyl-3,5-dihydro-2H-1,4-dithiepine?
The canonical SMILES for 3-methoxy-5,7-dimethyl-3,5-dihydro-2H-1,4-dithiepine is COC1CSC(C)=CC(C)S1.
What is the InChIKey of 3-methoxy-5,7-dimethyl-3,5-dihydro-2H-1,4-dithiepine?
The InChIKey is AOAXDPMLGJXRPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14OS2/c1-6-4-7(2)11-8(9-3)5-10-6/h4,7-8H,5H2,1-3H3.
What are the key properties of 3-methoxy-5,7-dimethyl-3,5-dihydro-2H-1,4-dithiepine?
3-methoxy-5,7-dimethyl-3,5-dihydro-2H-1,4-dithiepine has a molecular weight of 190.33 g/mol, XLogP of 2.73, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-5,7-dimethyl-3,5-dihydro-2H-1,4-dithiepine is sourced from PubChem (CID 143850717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).