C7H12N2S — CID 143851361
S-[(3E,5E)-5-aminohepta-1,3,5-trien-4-yl]thiohydroxylamine (PubChem CID 143851361) has the molecular formula C7H12N2S and a molecular weight of 156.25 g/mol. Its IUPAC name is S-[(3E,5E)-5-aminohepta-1,3,5-trien-4-yl]thiohydroxylamine.
| Compound Name | S-[(3E,5E)-5-aminohepta-1,3,5-trien-4-yl]thiohydroxylamine |
|---|---|
| PubChem CID | 143851361 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | S-[(3E,5E)-5-aminohepta-1,3,5-trien-4-yl]thiohydroxylamine |
| SMILES | C=C/C=C(SN)\C(N)=C/C |
| InChI | InChI=1S/C7H12N2S/c1-3-5-7(10-9)6(8)4-2/h3-5H,1,8-9H2,2H3/b6-4+,7-5+ |
| InChIKey | CBQZREMLRLYDKQ-YDFGWWAZSA-N |
| XLogP | 1.53 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|